About (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate
(2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate (PubChem CID 888123) has the molecular formula C20H16O3
and a molecular weight of 304.34 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate.
Molecular Properties
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate |
| PubChem CID | 888123 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16O3/c21-19(14-23-20(22)12-15-6-2-1-3-7-15)18-11-10-16-8-4-5-9-17(16)13-18/h1-11,13H,12,14H2 |
| InChIKey | RFDZHVLZJXQTBR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate?
The IUPAC name of (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate (CID 888123) is (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate.
What is the SMILES notation for (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate?
The canonical SMILES for (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate is O=C(Cc1ccccc1)OCC(=O)c1ccc2ccccc2c1.
What is the InChIKey of (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate?
The InChIKey is RFDZHVLZJXQTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O3/c21-19(14-23-20(22)12-15-6-2-1-3-7-15)18-11-10-16-8-4-5-9-17(16)13-18/h1-11,13H,12,14H2.
What are the key properties of (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate?
(2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate has a molecular weight of 304.34 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-naphthalen-2-yl-2-oxoethyl) 2-phenylacetate is sourced from PubChem (CID 888123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).