C21H42O2S — CID 88812428
3-[(Z)-octadec-9-enyl]sulfanylpropane-1,2-diol (PubChem CID 88812428) has the molecular formula C21H42O2S and a molecular weight of 358.63 g/mol. Its IUPAC name is 3-[(Z)-octadec-9-enyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[(Z)-octadec-9-enyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 88812428 |
| Molecular Formula | C21H42O2S |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 3-[(Z)-octadec-9-enyl]sulfanylpropane-1,2-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCSCC(O)CO |
| InChI | InChI=1S/C21H42O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h9-10,21-23H,2-8,11-20H2,1H3/b10-9- |
| InChIKey | NICTVZMMBJWGLW-KTKRTIGZSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|