C40H78O5 — CID 88812441
bis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-hydroxybutanedioate (PubChem CID 88812441) has the molecular formula C40H78O5 and a molecular weight of 639.06 g/mol. Its IUPAC name is bis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-hydroxybutanedioate.
| Compound Name | bis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 88812441 |
| Molecular Formula | C40H78O5 |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.58 |
| IUPAC Name | bis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-hydroxybutanedioate |
| SMILES | CC(CCC(COC(=O)CC(O)C(=O)OCC(CCC(C)CC(C)(C)C)C(C)CC(C)(C)C)C(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C40H78O5/c1-28(22-37(5,6)7)17-19-32(30(3)24-39(11,12)13)26-44-35(42)21-34(41)36(43)45-27-33(31(4)25-40(14,15)16)20-18-29(2)23-38(8,9)10/h28-34,41H,17-27H2,1-16H3 |
| InChIKey | ONKLPOGLHLITSO-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |