C7H18CuN2O4 — CID 88812819
1-amino-2-(2-hydroxyethylamino)pentane-1,1,2-triol;copper (PubChem CID 88812819) has the molecular formula C7H18CuN2O4 and a molecular weight of 257.78 g/mol. Its IUPAC name is 1-amino-2-(2-hydroxyethylamino)pentane-1,1,2-triol;copper.
| Compound Name | 1-amino-2-(2-hydroxyethylamino)pentane-1,1,2-triol;copper |
|---|---|
| PubChem CID | 88812819 |
| Molecular Formula | C7H18CuN2O4 |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-amino-2-(2-hydroxyethylamino)pentane-1,1,2-triol;copper |
| SMILES | CCCC(O)(NCCO)C(N)(O)O.[Cu] |
| InChI | InChI=1S/C7H18N2O4.Cu/c1-2-3-6(11,7(8,12)13)9-4-5-10;/h9-13H,2-5,8H2,1H3; |
| InChIKey | BERNCNCELBULGF-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|