About N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide
N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide (PubChem CID 88813205) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide.
Molecular Properties
| Compound Name | N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide |
| PubChem CID | 88813205 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide |
| SMILES | C=CCC/N=C(\CC#N)N(C#N)CCC |
| InChI | InChI=1S/C11H16N4/c1-3-5-8-14-11(6-7-12)15(10-13)9-4-2/h3H,1,4-6,8-9H2,2H3/b14-11+ |
| InChIKey | RLPKTQKODBMVGH-SDNWHVSQSA-N |
| XLogP | 2.07 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide?
The IUPAC name of N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide (CID 88813205) is N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide.
What is the SMILES notation for N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide?
The canonical SMILES for N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide is C=CCC/N=C(\CC#N)N(C#N)CCC.
What is the InChIKey of N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide?
The InChIKey is RLPKTQKODBMVGH-SDNWHVSQSA-N. The full InChI is InChI=1S/C11H16N4/c1-3-5-8-14-11(6-7-12)15(10-13)9-4-2/h3H,1,4-6,8-9H2,2H3/b14-11+.
What are the key properties of N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide?
N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide has a molecular weight of 204.28 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-but-3-enyl-N,2-dicyano-N-propylethanimidamide is sourced from PubChem (CID 88813205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).