About [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate
[1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate (PubChem CID 88813662) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate.
Molecular Properties
| Compound Name | [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate |
| PubChem CID | 88813662 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate |
| SMILES | CC(=O)OC(C(C)(C)CO)C12C=CCC1C2C=O |
| InChI | InChI=1S/C14H20O4/c1-9(17)18-12(13(2,3)8-16)14-6-4-5-10(14)11(14)7-15/h4,6-7,10-12,16H,5,8H2,1-3H3 |
| InChIKey | ITAZRCLHVFIMEN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate?
The IUPAC name of [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate (CID 88813662) is [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate.
What is the SMILES notation for [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate?
The canonical SMILES for [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate is CC(=O)OC(C(C)(C)CO)C12C=CCC1C2C=O.
What is the InChIKey of [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate?
The InChIKey is ITAZRCLHVFIMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-9(17)18-12(13(2,3)8-16)14-6-4-5-10(14)11(14)7-15/h4,6-7,10-12,16H,5,8H2,1-3H3.
What are the key properties of [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate?
[1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate has a molecular weight of 252.31 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-formyl-1-bicyclo[3.1.0]hex-2-enyl)-3-hydroxy-2,2-dimethylpropyl] acetate is sourced from PubChem (CID 88813662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).