C27H35NO4 — CID 88813828
[(3E,8R,9S,10R,13S,14S,17R)-3-acetyloxyimino-13-ethyl-17-ethynyl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 88813828) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is [(3E,8R,9S,10R,13S,14S,17R)-3-acetyloxyimino-13-ethyl-17-ethynyl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(3E,8R,9S,10R,13S,14S,17R)-3-acetyloxyimino-13-ethyl-17-ethynyl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 88813828 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | [(3E,8R,9S,10R,13S,14S,17R)-3-acetyloxyimino-13-ethyl-17-ethynyl-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | C#C[C@]1(OC(=O)CCC)C=C[C@H]2[C@@H]3CCC4=C/C(=N/OC(C)=O)CC[C@@H]4[C@H]3CC[C@@]21CC |
| InChI | InChI=1S/C27H35NO4/c1-5-8-25(30)31-27(7-3)16-14-24-23-11-9-19-17-20(28-32-18(4)29)10-12-21(19)22(23)13-15-26(24,27)6-2/h3,14,16-17,21-24H,5-6,8-13,15H2,1-2,4H3/b28-20+/t21-,22+,23+,24-,26-,27-/m0/s1 |
| InChIKey | NGFNDBYXJCVYCG-LICSWBFFSA-N |
| XLogP | 5.36 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|