About (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one
(5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 88814103) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one.
Molecular Properties
| Compound Name | (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one |
| PubChem CID | 88814103 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | [H]/N=C(\C/C=C(\C)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C13H21NO/c1-10(2)6-5-7-11(3)8-9-13(14)12(4)15/h6,8,14H,5,7,9H2,1-4H3/b11-8+,14-13+ |
| InChIKey | GIHSGYNQLRQUAH-ZOBWXTBZSA-N |
| XLogP | 3.68 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one?
The IUPAC name of (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one (CID 88814103) is (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one.
What is the SMILES notation for (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one?
The canonical SMILES for (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one is [H]/N=C(\C/C=C(\C)CCC=C(C)C)C(C)=O.
What is the InChIKey of (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one?
The InChIKey is GIHSGYNQLRQUAH-ZOBWXTBZSA-N. The full InChI is InChI=1S/C13H21NO/c1-10(2)6-5-7-11(3)8-9-13(14)12(4)15/h6,8,14H,5,7,9H2,1-4H3/b11-8+,14-13+.
What are the key properties of (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one?
(5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one has a molecular weight of 207.32 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-imino-6,10-dimethylundeca-5,9-dien-2-one is sourced from PubChem (CID 88814103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).