About propa-1,2-diene-1,1-dithiol
propa-1,2-diene-1,1-dithiol (PubChem CID 88814621) has the molecular formula C3H4S2
and a molecular weight of 104.20 g/mol. Its IUPAC name is propa-1,2-diene-1,1-dithiol.
Molecular Properties
| Compound Name | propa-1,2-diene-1,1-dithiol |
| PubChem CID | 88814621 |
| Molecular Formula | C3H4S2 |
| Molecular Weight | 104.20 g/mol |
| Exact Mass | 103.98 |
| IUPAC Name | propa-1,2-diene-1,1-dithiol |
| SMILES | C=C=C(S)S |
| InChI | InChI=1S/C3H4S2/c1-2-3(4)5/h4-5H,1H2 |
| InChIKey | RXOUYOIWFTYIBD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propa-1,2-diene-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propa-1,2-diene-1,1-dithiol?
The IUPAC name of propa-1,2-diene-1,1-dithiol (CID 88814621) is propa-1,2-diene-1,1-dithiol.
What is the SMILES notation for propa-1,2-diene-1,1-dithiol?
The canonical SMILES for propa-1,2-diene-1,1-dithiol is C=C=C(S)S.
What is the InChIKey of propa-1,2-diene-1,1-dithiol?
The InChIKey is RXOUYOIWFTYIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4S2/c1-2-3(4)5/h4-5H,1H2.
What are the key properties of propa-1,2-diene-1,1-dithiol?
propa-1,2-diene-1,1-dithiol has a molecular weight of 104.20 g/mol, XLogP of 1.47, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propa-1,2-diene-1,1-dithiol is sourced from PubChem (CID 88814621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).