C14H26O2 — CID 88815538
2,9,9-trimethyl-7-methylidenedec-1-ene-1,5-diol (PubChem CID 88815538) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,9,9-trimethyl-7-methylidenedec-1-ene-1,5-diol.
| Compound Name | 2,9,9-trimethyl-7-methylidenedec-1-ene-1,5-diol |
|---|---|
| PubChem CID | 88815538 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,9,9-trimethyl-7-methylidenedec-1-ene-1,5-diol |
| SMILES | C=C(CC(O)CCC(C)=CO)CC(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-11(10-15)6-7-13(16)8-12(2)9-14(3,4)5/h10,13,15-16H,2,6-9H2,1,3-5H3 |
| InChIKey | VZRPGFKPBSNJSC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|