About ethanol;ethyl 2-hydroxypropanoate;propan-2-one
ethanol;ethyl 2-hydroxypropanoate;propan-2-one (PubChem CID 88815553) has the molecular formula C10H22O5
and a molecular weight of 222.28 g/mol. Its IUPAC name is ethanol;ethyl 2-hydroxypropanoate;propan-2-one.
Molecular Properties
| Compound Name | ethanol;ethyl 2-hydroxypropanoate;propan-2-one |
| PubChem CID | 88815553 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | ethanol;ethyl 2-hydroxypropanoate;propan-2-one |
| SMILES | CC(C)=O.CCO.CCOC(=O)C(C)O |
| InChI | InChI=1S/C5H10O3.C3H6O.C2H6O/c1-3-8-5(7)4(2)6;1-3(2)4;1-2-3/h4,6H,3H2,1-2H3;1-2H3;3H,2H2,1H3 |
| InChIKey | LCRAZUBMIGNCFX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethanol;ethyl 2-hydroxypropanoate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl 2-hydroxypropanoate;propan-2-one?
The IUPAC name of ethanol;ethyl 2-hydroxypropanoate;propan-2-one (CID 88815553) is ethanol;ethyl 2-hydroxypropanoate;propan-2-one.
What is the SMILES notation for ethanol;ethyl 2-hydroxypropanoate;propan-2-one?
The canonical SMILES for ethanol;ethyl 2-hydroxypropanoate;propan-2-one is CC(C)=O.CCO.CCOC(=O)C(C)O.
What is the InChIKey of ethanol;ethyl 2-hydroxypropanoate;propan-2-one?
The InChIKey is LCRAZUBMIGNCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C3H6O.C2H6O/c1-3-8-5(7)4(2)6;1-3(2)4;1-2-3/h4,6H,3H2,1-2H3;1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl 2-hydroxypropanoate;propan-2-one?
ethanol;ethyl 2-hydroxypropanoate;propan-2-one has a molecular weight of 222.28 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl 2-hydroxypropanoate;propan-2-one is sourced from PubChem (CID 88815553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).