About chloro-diethyl-phenyl-λ5-phosphane;gold
chloro-diethyl-phenyl-λ5-phosphane;gold (PubChem CID 88815875) has the molecular formula C10H16AuClP
and a molecular weight of 399.63 g/mol. Its IUPAC name is chloro-diethyl-phenyl-λ5-phosphane;gold.
Molecular Properties
| Compound Name | chloro-diethyl-phenyl-λ5-phosphane;gold |
| PubChem CID | 88815875 |
| Molecular Formula | C10H16AuClP |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | chloro-diethyl-phenyl-λ5-phosphane;gold |
| SMILES | CC[PH](Cl)(CC)c1ccccc1.[Au] |
| InChI | InChI=1S/C10H16ClP.Au/c1-3-12(11,4-2)10-8-6-5-7-9-10;/h5-9,12H,3-4H2,1-2H3; |
| InChIKey | CEDFTFXCQHWRKX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-diethyl-phenyl-λ5-phosphane;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-diethyl-phenyl-λ5-phosphane;gold?
The IUPAC name of chloro-diethyl-phenyl-λ5-phosphane;gold (CID 88815875) is chloro-diethyl-phenyl-λ5-phosphane;gold.
What is the SMILES notation for chloro-diethyl-phenyl-λ5-phosphane;gold?
The canonical SMILES for chloro-diethyl-phenyl-λ5-phosphane;gold is CC[PH](Cl)(CC)c1ccccc1.[Au].
What is the InChIKey of chloro-diethyl-phenyl-λ5-phosphane;gold?
The InChIKey is CEDFTFXCQHWRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClP.Au/c1-3-12(11,4-2)10-8-6-5-7-9-10;/h5-9,12H,3-4H2,1-2H3;.
What are the key properties of chloro-diethyl-phenyl-λ5-phosphane;gold?
chloro-diethyl-phenyl-λ5-phosphane;gold has a molecular weight of 399.63 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-diethyl-phenyl-λ5-phosphane;gold is sourced from PubChem (CID 88815875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).