About propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate
propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate (PubChem CID 88816144) has the molecular formula C17H35N3O2S2
and a molecular weight of 377.62 g/mol. Its IUPAC name is propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate.
Molecular Properties
| Compound Name | propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate |
| PubChem CID | 88816144 |
| Molecular Formula | C17H35N3O2S2 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate |
| SMILES | CCCC/N=C(/NC(=O)N(SCCCC)SCCCC)OC(C)C |
| InChI | InChI=1S/C17H35N3O2S2/c1-6-9-12-18-16(22-15(4)5)19-17(21)20(23-13-10-7-2)24-14-11-8-3/h15H,6-14H2,1-5H3,(H,18,19,21) |
| InChIKey | FRFQIDKQWLATLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate?
The IUPAC name of propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate (CID 88816144) is propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate.
What is the SMILES notation for propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate?
The canonical SMILES for propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate is CCCC/N=C(/NC(=O)N(SCCCC)SCCCC)OC(C)C.
What is the InChIKey of propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate?
The InChIKey is FRFQIDKQWLATLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3O2S2/c1-6-9-12-18-16(22-15(4)5)19-17(21)20(23-13-10-7-2)24-14-11-8-3/h15H,6-14H2,1-5H3,(H,18,19,21).
What are the key properties of propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate?
propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate has a molecular weight of 377.62 g/mol, XLogP of 5.48, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[bis(butylsulfanyl)carbamoyl]-N'-butylcarbamimidate is sourced from PubChem (CID 88816144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).