C17H15NO2S2 — CID 8881643
(5Z)-5-[(2-ethyl-1-benzofuran-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 8881643) has the molecular formula C17H15NO2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is (5Z)-5-[(2-ethyl-1-benzofuran-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-ethyl-1-benzofuran-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 8881643 |
| Molecular Formula | C17H15NO2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (5Z)-5-[(2-ethyl-1-benzofuran-3-yl)methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2c(CC)oc3ccccc23)SC1=S |
| InChI | InChI=1S/C17H15NO2S2/c1-3-9-18-16(19)15(22-17(18)21)10-12-11-7-5-6-8-14(11)20-13(12)4-2/h3,5-8,10H,1,4,9H2,2H3/b15-10- |
| InChIKey | WTJNSIONMGIIDD-GDNBJRDFSA-N |
| XLogP | 4.38 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|