About butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate
butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate (PubChem CID 88816705) has the molecular formula C15H31N3O2S2
and a molecular weight of 349.57 g/mol. Its IUPAC name is butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate.
Molecular Properties
| Compound Name | butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate |
| PubChem CID | 88816705 |
| Molecular Formula | C15H31N3O2S2 |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate |
| SMILES | CCC(C)O/C(=N\C(C)C)NC(=O)N(SC(C)C)SC(C)C |
| InChI | InChI=1S/C15H31N3O2S2/c1-9-13(8)20-14(16-10(2)3)17-15(19)18(21-11(4)5)22-12(6)7/h10-13H,9H2,1-8H3,(H,16,17,19) |
| InChIKey | OPQLTLCZUMJYGY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate?
The IUPAC name of butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate (CID 88816705) is butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate.
What is the SMILES notation for butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate?
The canonical SMILES for butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate is CCC(C)O/C(=N\C(C)C)NC(=O)N(SC(C)C)SC(C)C.
What is the InChIKey of butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate?
The InChIKey is OPQLTLCZUMJYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O2S2/c1-9-13(8)20-14(16-10(2)3)17-15(19)18(21-11(4)5)22-12(6)7/h10-13H,9H2,1-8H3,(H,16,17,19).
What are the key properties of butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate?
butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate has a molecular weight of 349.57 g/mol, XLogP of 4.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl N-[bis(propan-2-ylsulfanyl)carbamoyl]-N'-propan-2-ylcarbamimidate is sourced from PubChem (CID 88816705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).