C15H16Br4O7 — CID 88816770
2-O-(3-ethoxy-2-hydroxypropyl) 1-O-(2-hydroxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate (PubChem CID 88816770) has the molecular formula C15H16Br4O7 and a molecular weight of 627.90 g/mol. Its IUPAC name is 2-O-(3-ethoxy-2-hydroxypropyl) 1-O-(2-hydroxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate.
| Compound Name | 2-O-(3-ethoxy-2-hydroxypropyl) 1-O-(2-hydroxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 88816770 |
| Molecular Formula | C15H16Br4O7 |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 623.76 |
| IUPAC Name | 2-O-(3-ethoxy-2-hydroxypropyl) 1-O-(2-hydroxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
| SMILES | CCOCC(O)COC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCCO |
| InChI | InChI=1S/C15H16Br4O7/c1-2-24-5-7(21)6-26-15(23)9-8(14(22)25-4-3-20)10(16)12(18)13(19)11(9)17/h7,20-21H,2-6H2,1H3 |
| InChIKey | GRXODBUBBVUZPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|