About dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate
dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate (PubChem CID 88817079) has the molecular formula C6H8Cl3O4P
and a molecular weight of 281.46 g/mol. Its IUPAC name is dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate.
Molecular Properties
| Compound Name | dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate |
| PubChem CID | 88817079 |
| Molecular Formula | C6H8Cl3O4P |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 279.92 |
| IUPAC Name | dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate |
| SMILES | COP(=O)(OC)O/C=C(/Cl)C=C(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3O4P/c1-11-14(10,12-2)13-4-5(7)3-6(8)9/h3-4H,1-2H3/b5-4+ |
| InChIKey | USKOIKHKQISPHC-SNAWJCMRSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate?
The IUPAC name of dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate (CID 88817079) is dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate.
What is the SMILES notation for dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate?
The canonical SMILES for dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate is COP(=O)(OC)O/C=C(/Cl)C=C(Cl)Cl.
What is the InChIKey of dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate?
The InChIKey is USKOIKHKQISPHC-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H8Cl3O4P/c1-11-14(10,12-2)13-4-5(7)3-6(8)9/h3-4H,1-2H3/b5-4+.
What are the key properties of dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate?
dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate has a molecular weight of 281.46 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate is sourced from PubChem (CID 88817079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).