C12H36O9P2 — CID 88817150
bis(diethyl(trihydroxy)-λ5-phosphane);2-(2-hydroxyethoxy)ethanol (PubChem CID 88817150) has the molecular formula C12H36O9P2 and a molecular weight of 386.36 g/mol. Its IUPAC name is bis(diethyl(trihydroxy)-λ5-phosphane);2-(2-hydroxyethoxy)ethanol.
| Compound Name | bis(diethyl(trihydroxy)-λ5-phosphane);2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 88817150 |
| Molecular Formula | C12H36O9P2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | bis(diethyl(trihydroxy)-λ5-phosphane);2-(2-hydroxyethoxy)ethanol |
| SMILES | CCP(O)(O)(O)CC.CCP(O)(O)(O)CC.OCCOCCO |
| InChI | InChI=1S/2C4H13O3P.C4H10O3/c2*1-3-8(5,6,7)4-2;5-1-3-7-4-2-6/h2*5-7H,3-4H2,1-2H3;5-6H,1-4H2 |
| InChIKey | XQFZMZWPQYILLE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|