About 1,4-dioxane;nitromethane;trioxane
1,4-dioxane;nitromethane;trioxane (PubChem CID 88818330) has the molecular formula C8H17NO7
and a molecular weight of 239.22 g/mol. Its IUPAC name is 1,4-dioxane;nitromethane;trioxane.
Molecular Properties
| Compound Name | 1,4-dioxane;nitromethane;trioxane |
| PubChem CID | 88818330 |
| Molecular Formula | C8H17NO7 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1,4-dioxane;nitromethane;trioxane |
| SMILES | C1COCCO1.C1COOOC1.C[N+](=O)[O-] |
| InChI | InChI=1S/C4H8O2.C3H6O3.CH3NO2/c1-2-6-4-3-5-1;1-2-4-6-5-3-1;1-2(3)4/h1-4H2;1-3H2;1H3 |
| InChIKey | ATVCVMNUXFSVMH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane;nitromethane;trioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;nitromethane;trioxane?
The IUPAC name of 1,4-dioxane;nitromethane;trioxane (CID 88818330) is 1,4-dioxane;nitromethane;trioxane.
What is the SMILES notation for 1,4-dioxane;nitromethane;trioxane?
The canonical SMILES for 1,4-dioxane;nitromethane;trioxane is C1COCCO1.C1COOOC1.C[N+](=O)[O-].
What is the InChIKey of 1,4-dioxane;nitromethane;trioxane?
The InChIKey is ATVCVMNUXFSVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H6O3.CH3NO2/c1-2-6-4-3-5-1;1-2-4-6-5-3-1;1-2(3)4/h1-4H2;1-3H2;1H3.
What are the key properties of 1,4-dioxane;nitromethane;trioxane?
1,4-dioxane;nitromethane;trioxane has a molecular weight of 239.22 g/mol, XLogP of 0.20, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;nitromethane;trioxane is sourced from PubChem (CID 88818330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).