C27H44O4 — CID 88818597
(3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,1,3-triol (PubChem CID 88818597) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,1,3-triol.
| Compound Name | (3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,1,3-triol |
|---|---|
| PubChem CID | 88818597 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,1,3-triol |
| SMILES | C=C1/C(=C\C=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCC(O)C(C)C)CC(O)(O)C[C@H]1O |
| InChI | InChI=1S/C27H44O4/c1-17(2)24(28)13-8-18(3)22-11-12-23-20(7-6-14-26(22,23)5)9-10-21-15-27(30,31)16-25(29)19(21)4/h9-10,17-18,22-25,28-31H,4,6-8,11-16H2,1-3,5H3/b20-9?,21-10-/t18-,22-,23?,24?,25-,26-/m1/s1 |
| InChIKey | JFBPIWUVQWKQKD-WRVOEFAVSA-N |
| XLogP | 4.88 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|