C30H26N2O8S2 — CID 88818870
benzhydryl (6R)-8-oxo-3-propanoylperoxycarbonyl-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88818870) has the molecular formula C30H26N2O8S2 and a molecular weight of 606.68 g/mol. Its IUPAC name is benzhydryl (6R)-8-oxo-3-propanoylperoxycarbonyl-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-8-oxo-3-propanoylperoxycarbonyl-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88818870 |
| Molecular Formula | C30H26N2O8S2 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | benzhydryl (6R)-8-oxo-3-propanoylperoxycarbonyl-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC(=O)OOC(=O)C1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3cccs3)[C@H]2SC1 |
| InChI | InChI=1S/C30H26N2O8S2/c1-2-23(34)39-40-29(36)21-17-42-28-24(31-22(33)16-20-14-9-15-41-20)27(35)32(28)25(21)30(37)38-26(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-15,24,26,28H,2,16-17H2,1H3,(H,31,33)/t24?,28-/m1/s1 |
| InChIKey | ZJRQRNBYDAPUDZ-ITCMONMYSA-N |
| XLogP | 3.69 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|