About CID 88818947
CID 88818947 (PubChem CID 88818947) has the molecular formula C5H9LiNO3
and a molecular weight of 138.07 g/mol.
Molecular Properties
| Compound Name | CID 88818947 |
| PubChem CID | 88818947 |
| Molecular Formula | C5H9LiNO3 |
| Molecular Weight | 138.07 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | — |
| SMILES | CCC(=O)C(C)[N+](=O)[O-].[Li] |
| InChI | InChI=1S/C5H9NO3.Li/c1-3-5(7)4(2)6(8)9;/h4H,3H2,1-2H3; |
| InChIKey | KERIWMJMQYLWKD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.07 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 88818947 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88818947?
The IUPAC name of CID 88818947 (CID 88818947) is not available.
What is the SMILES notation for CID 88818947?
The canonical SMILES for CID 88818947 is CCC(=O)C(C)[N+](=O)[O-].[Li].
What is the InChIKey of CID 88818947?
The InChIKey is KERIWMJMQYLWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.Li/c1-3-5(7)4(2)6(8)9;/h4H,3H2,1-2H3;.
What are the key properties of CID 88818947?
CID 88818947 has a molecular weight of 138.07 g/mol, XLogP of 0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88818947 is sourced from PubChem (CID 88818947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).