C34H59NO3 — CID 88819055
[(2R,5S,7S,9R,15R,16R)-9-[(dimethylamino)methyl]-15-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] acetate (PubChem CID 88819055) has the molecular formula C34H59NO3 and a molecular weight of 529.85 g/mol. Its IUPAC name is [(2R,5S,7S,9R,15R,16R)-9-[(dimethylamino)methyl]-15-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] acetate.
| Compound Name | [(2R,5S,7S,9R,15R,16R)-9-[(dimethylamino)methyl]-15-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] acetate |
|---|---|
| PubChem CID | 88819055 |
| Molecular Formula | C34H59NO3 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 529.45 |
| IUPAC Name | [(2R,5S,7S,9R,15R,16R)-9-[(dimethylamino)methyl]-15-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] acetate |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CCC2C3C[C@]4(CN(C)C)O[C@]45C[C@@H](OC(C)=O)CC[C@]5(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C34H59NO3/c1-10-25(22(2)3)12-11-23(4)28-13-14-29-27-20-33(21-35(8)9)34(38-33)19-26(37-24(5)36)15-18-32(34,7)30(27)16-17-31(28,29)6/h22-23,25-30H,10-21H2,1-9H3/t23-,25-,26+,27?,28-,29?,30?,31-,32-,33-,34+/m1/s1 |
| InChIKey | WNEUAXGZIAOPKN-KCASILOYSA-N |
| XLogP | 7.74 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|