About azane;1-nitrohexadecan-2-one
azane;1-nitrohexadecan-2-one (PubChem CID 88819593) has the molecular formula C16H34N2O3
and a molecular weight of 302.46 g/mol. Its IUPAC name is azane;1-nitrohexadecan-2-one.
Molecular Properties
| Compound Name | azane;1-nitrohexadecan-2-one |
| PubChem CID | 88819593 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | azane;1-nitrohexadecan-2-one |
| SMILES | CCCCCCCCCCCCCCC(=O)C[N+](=O)[O-].N |
| InChI | InChI=1S/C16H31NO3.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18)15-17(19)20;/h2-15H2,1H3;1H3 |
| InChIKey | QEMWLSOPSBWEJX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;1-nitrohexadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-nitrohexadecan-2-one?
The IUPAC name of azane;1-nitrohexadecan-2-one (CID 88819593) is azane;1-nitrohexadecan-2-one.
What is the SMILES notation for azane;1-nitrohexadecan-2-one?
The canonical SMILES for azane;1-nitrohexadecan-2-one is CCCCCCCCCCCCCCC(=O)C[N+](=O)[O-].N.
What is the InChIKey of azane;1-nitrohexadecan-2-one?
The InChIKey is QEMWLSOPSBWEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18)15-17(19)20;/h2-15H2,1H3;1H3.
What are the key properties of azane;1-nitrohexadecan-2-one?
azane;1-nitrohexadecan-2-one has a molecular weight of 302.46 g/mol, XLogP of 5.09, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-nitrohexadecan-2-one is sourced from PubChem (CID 88819593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).