C21H26BrFO3 — CID 88820083
(6S,8S,10R,13S,14S,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88820083) has the molecular formula C21H26BrFO3 and a molecular weight of 425.34 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,10R,13S,14S,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88820083 |
| Molecular Formula | C21H26BrFO3 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (6S,8S,10R,13S,14S,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1[C@@H](F)C[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CBr |
| InChI | InChI=1S/C21H26BrFO3/c1-19-6-3-12(24)9-16(19)17(23)10-13-14(19)4-7-20(2)15(13)5-8-21(20,26)18(25)11-22/h4,9,13,15,17,26H,3,5-8,10-11H2,1-2H3/t13-,15+,17+,19-,20+,21+/m1/s1 |
| InChIKey | UJMHBKDQWSYFPN-ISBFPKGDSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|