C24H25BrCl2N4 — CID 88820107
N-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrobromide (PubChem CID 88820107) has the molecular formula C24H25BrCl2N4 and a molecular weight of 520.30 g/mol. Its IUPAC name is N-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrobromide.
| Compound Name | N-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 88820107 |
| Molecular Formula | C24H25BrCl2N4 |
| Molecular Weight | 520.30 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | N-[1,5-bis(4-chlorophenyl)penta-1,4-dien-3-ylideneamino]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-amine;hydrobromide |
| SMILES | Br.Clc1ccc(C=CC(C=Cc2ccc(Cl)cc2)=NNC2=NC3CCCCC3N2)cc1 |
| InChI | InChI=1S/C24H24Cl2N4.BrH/c25-19-11-5-17(6-12-19)9-15-21(16-10-18-7-13-20(26)14-8-18)29-30-24-27-22-3-1-2-4-23(22)28-24;/h5-16,22-23H,1-4H2,(H2,27,28,30);1H |
| InChIKey | XJQKCMDQCLPARE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.30 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|