About [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate
[2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate (PubChem CID 88820225) has the molecular formula C18H13Cl2N3S2
and a molecular weight of 406.36 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate.
Molecular Properties
| Compound Name | [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate |
| PubChem CID | 88820225 |
| Molecular Formula | C18H13Cl2N3S2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate |
| SMILES | N#CSC(C(Sc1ccc(Cl)cc1Cl)c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C18H13Cl2N3S2/c19-14-6-7-16(15(20)10-14)25-17(13-4-2-1-3-5-13)18(24-11-21)23-9-8-22-12-23/h1-10,12,17-18H |
| InChIKey | KZXVFAIVMICTJU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate?
The IUPAC name of [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate (CID 88820225) is [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate.
What is the SMILES notation for [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate?
The canonical SMILES for [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate is N#CSC(C(Sc1ccc(Cl)cc1Cl)c1ccccc1)n1ccnc1.
What is the InChIKey of [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate?
The InChIKey is KZXVFAIVMICTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3S2/c19-14-6-7-16(15(20)10-14)25-17(13-4-2-1-3-5-13)18(24-11-21)23-9-8-22-12-23/h1-10,12,17-18H.
What are the key properties of [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate?
[2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate has a molecular weight of 406.36 g/mol, XLogP of 6.44, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dichlorophenyl)sulfanyl-1-imidazol-1-yl-2-phenylethyl] thiocyanate is sourced from PubChem (CID 88820225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).