About 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde
2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde (PubChem CID 88820261) has the molecular formula C32H22O2
and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde |
| PubChem CID | 88820261 |
| Molecular Formula | C32H22O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde |
| SMILES | O=CC(=O)c1c(-c2ccccc2)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H22O2/c33-22-29(34)32-28(24-15-7-2-8-16-24)21-27(23-13-5-1-6-14-23)30(25-17-9-3-10-18-25)31(32)26-19-11-4-12-20-26/h1-22H |
| InChIKey | HREXSXRXNLKIKY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde?
The IUPAC name of 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde (CID 88820261) is 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde.
What is the SMILES notation for 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde?
The canonical SMILES for 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde is O=CC(=O)c1c(-c2ccccc2)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde?
The InChIKey is HREXSXRXNLKIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22O2/c33-22-29(34)32-28(24-15-7-2-8-16-24)21-27(23-13-5-1-6-14-23)30(25-17-9-3-10-18-25)31(32)26-19-11-4-12-20-26/h1-22H.
What are the key properties of 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde?
2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde has a molecular weight of 438.53 g/mol, XLogP of 7.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-(2,3,4,6-tetraphenylphenyl)acetaldehyde is sourced from PubChem (CID 88820261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).