C21H25BrO3 — CID 88820373
(8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 88820373) has the molecular formula C21H25BrO3 and a molecular weight of 405.33 g/mol. Its IUPAC name is (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88820373 |
| Molecular Formula | C21H25BrO3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13-dimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CBr |
| InChI | InChI=1S/C21H25BrO3/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h5-6,8,11,15,17,25H,3-4,7,9-10,12H2,1-2H3/t15-,17+,19+,20+,21+/m1/s1 |
| InChIKey | KPCAXQDFIPHWIT-ONKRVSLGSA-N |
| XLogP | 3.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|