C22H29BrO3 — CID 88820386
(8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88820386) has the molecular formula C22H29BrO3 and a molecular weight of 421.38 g/mol. Its IUPAC name is (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88820386 |
| Molecular Formula | C22H29BrO3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-(2-bromoacetyl)-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)C(=O)CBr |
| InChI | InChI=1S/C22H29BrO3/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h7,11,13,16,18,26H,4-6,8-10,12H2,1-3H3/t13?,16-,18+,20+,21+,22+/m1/s1 |
| InChIKey | ZEVSOHFGRMARMB-VTZACXCQSA-N |
| XLogP | 4.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|