C24H30N2O2S — CID 88820907
(3aS,6aR)-1,3-dibenzyl-4-(3-ethoxypropyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one (PubChem CID 88820907) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is (3aS,6aR)-1,3-dibenzyl-4-(3-ethoxypropyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,6aR)-1,3-dibenzyl-4-(3-ethoxypropyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 88820907 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3aS,6aR)-1,3-dibenzyl-4-(3-ethoxypropyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CCOCCCC1SC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-2-28-15-9-14-22-23-21(18-29-22)25(16-19-10-5-3-6-11-19)24(27)26(23)17-20-12-7-4-8-13-20/h3-8,10-13,21-23H,2,9,14-18H2,1H3/t21-,22?,23-/m0/s1 |
| InChIKey | RJVYOOHURVDBSW-LIMDNCRJSA-N |
| XLogP | 4.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|