C28H20N4O2 — CID 88821143
1-N,1-N'-bis(2-isocyanatophenyl)-1-N,1-N'-diphenylethene-1,1-diamine (PubChem CID 88821143) has the molecular formula C28H20N4O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1-N,1-N'-bis(2-isocyanatophenyl)-1-N,1-N'-diphenylethene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(2-isocyanatophenyl)-1-N,1-N'-diphenylethene-1,1-diamine |
|---|---|
| PubChem CID | 88821143 |
| Molecular Formula | C28H20N4O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-N,1-N'-bis(2-isocyanatophenyl)-1-N,1-N'-diphenylethene-1,1-diamine |
| SMILES | C=C(N(c1ccccc1)c1ccccc1N=C=O)N(c1ccccc1)c1ccccc1N=C=O |
| InChI | InChI=1S/C28H20N4O2/c1-22(31(23-12-4-2-5-13-23)27-18-10-8-16-25(27)29-20-33)32(24-14-6-3-7-15-24)28-19-11-9-17-26(28)30-21-34/h2-19H,1H2 |
| InChIKey | UHXYFBULXDLRHW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|