About (E)-10-methoxy-6,10-dimethylundec-5-en-2-one
(E)-10-methoxy-6,10-dimethylundec-5-en-2-one (PubChem CID 88821326) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-10-methoxy-6,10-dimethylundec-5-en-2-one.
Molecular Properties
| Compound Name | (E)-10-methoxy-6,10-dimethylundec-5-en-2-one |
| PubChem CID | 88821326 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (E)-10-methoxy-6,10-dimethylundec-5-en-2-one |
| SMILES | COC(C)(C)CCC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C14H26O2/c1-12(8-6-10-13(2)15)9-7-11-14(3,4)16-5/h8H,6-7,9-11H2,1-5H3/b12-8+ |
| InChIKey | JOPVWCKOMRXEMO-XYOKQWHBSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-10-methoxy-6,10-dimethylundec-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-10-methoxy-6,10-dimethylundec-5-en-2-one?
The IUPAC name of (E)-10-methoxy-6,10-dimethylundec-5-en-2-one (CID 88821326) is (E)-10-methoxy-6,10-dimethylundec-5-en-2-one.
What is the SMILES notation for (E)-10-methoxy-6,10-dimethylundec-5-en-2-one?
The canonical SMILES for (E)-10-methoxy-6,10-dimethylundec-5-en-2-one is COC(C)(C)CCC/C(C)=C/CCC(C)=O.
What is the InChIKey of (E)-10-methoxy-6,10-dimethylundec-5-en-2-one?
The InChIKey is JOPVWCKOMRXEMO-XYOKQWHBSA-N. The full InChI is InChI=1S/C14H26O2/c1-12(8-6-10-13(2)15)9-7-11-14(3,4)16-5/h8H,6-7,9-11H2,1-5H3/b12-8+.
What are the key properties of (E)-10-methoxy-6,10-dimethylundec-5-en-2-one?
(E)-10-methoxy-6,10-dimethylundec-5-en-2-one has a molecular weight of 226.36 g/mol, XLogP of 3.90, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-methoxy-6,10-dimethylundec-5-en-2-one is sourced from PubChem (CID 88821326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).