C28H42O6 — CID 88821421
3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoic acid;butane-1,4-diol (PubChem CID 88821421) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoic acid;butane-1,4-diol.
| Compound Name | 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoic acid;butane-1,4-diol |
|---|---|
| PubChem CID | 88821421 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 3,3-bis(3-tert-butyl-4-hydroxyphenyl)butanoic acid;butane-1,4-diol |
| SMILES | CC(C)(C)c1cc(C(C)(CC(=O)O)c2ccc(O)c(C(C)(C)C)c2)ccc1O.OCCCCO |
| InChI | InChI=1S/C24H32O4.C4H10O2/c1-22(2,3)17-12-15(8-10-19(17)25)24(7,14-21(27)28)16-9-11-20(26)18(13-16)23(4,5)6;5-3-1-2-4-6/h8-13,25-26H,14H2,1-7H3,(H,27,28);5-6H,1-4H2 |
| InChIKey | HCVUKFPIBAPGJR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|