C14H20Br11O4P — CID 88821455
bis[3-bromo-2,2-bis(bromomethyl)propyl] 1,2,3,4,4-pentabromobutyl phosphate (PubChem CID 88821455) has the molecular formula C14H20Br11O4P and a molecular weight of 1162.23 g/mol. Its IUPAC name is bis[3-bromo-2,2-bis(bromomethyl)propyl] 1,2,3,4,4-pentabromobutyl phosphate.
| Compound Name | bis[3-bromo-2,2-bis(bromomethyl)propyl] 1,2,3,4,4-pentabromobutyl phosphate |
|---|---|
| PubChem CID | 88821455 |
| Molecular Formula | C14H20Br11O4P |
| Molecular Weight | 1162.23 g/mol |
| Exact Mass | 1151.21 |
| IUPAC Name | bis[3-bromo-2,2-bis(bromomethyl)propyl] 1,2,3,4,4-pentabromobutyl phosphate |
| SMILES | O=P(OCC(CBr)(CBr)CBr)(OCC(CBr)(CBr)CBr)OC(Br)C(Br)C(Br)C(Br)Br |
| InChI | InChI=1S/C14H20Br11O4P/c15-1-13(2-16,3-17)7-27-30(26,28-8-14(4-18,5-19)6-20)29-12(25)10(22)9(21)11(23)24/h9-12H,1-8H2 |
| InChIKey | PECDVDNETVCSQF-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.23 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|