About bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol
bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol (PubChem CID 88821487) has the molecular formula C7H6S
and a molecular weight of 122.19 g/mol. Its IUPAC name is bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol.
Molecular Properties
| Compound Name | bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol |
| PubChem CID | 88821487 |
| Molecular Formula | C7H6S |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol |
| SMILES | SC1c2cccc1c2 |
| InChI | InChI=1S/C7H6S/c8-7-5-2-1-3-6(7)4-5/h1-4,7-8H |
| InChIKey | OTUHTKMIMCDYFW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol?
The IUPAC name of bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol (CID 88821487) is bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol.
What is the SMILES notation for bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol?
The canonical SMILES for bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol is SC1c2cccc1c2.
What is the InChIKey of bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol?
The InChIKey is OTUHTKMIMCDYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6S/c8-7-5-2-1-3-6(7)4-5/h1-4,7-8H.
What are the key properties of bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol?
bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol has a molecular weight of 122.19 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.1]hepta-1(7),2,4-triene-6-thiol is sourced from PubChem (CID 88821487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).