About 1,2-dichloroethane;propan-1-ol;propan-2-one
1,2-dichloroethane;propan-1-ol;propan-2-one (PubChem CID 88821608) has the molecular formula C8H18Cl2O2
and a molecular weight of 217.14 g/mol. Its IUPAC name is 1,2-dichloroethane;propan-1-ol;propan-2-one.
Molecular Properties
| Compound Name | 1,2-dichloroethane;propan-1-ol;propan-2-one |
| PubChem CID | 88821608 |
| Molecular Formula | C8H18Cl2O2 |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1,2-dichloroethane;propan-1-ol;propan-2-one |
| SMILES | CC(C)=O.CCCO.ClCCCl |
| InChI | InChI=1S/C3H6O.C3H8O.C2H4Cl2/c1-3(2)4;1-2-3-4;3-1-2-4/h1-2H3;4H,2-3H2,1H3;1-2H2 |
| InChIKey | KAJMOJUSDSHMMZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloroethane;propan-1-ol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloroethane;propan-1-ol;propan-2-one?
The IUPAC name of 1,2-dichloroethane;propan-1-ol;propan-2-one (CID 88821608) is 1,2-dichloroethane;propan-1-ol;propan-2-one.
What is the SMILES notation for 1,2-dichloroethane;propan-1-ol;propan-2-one?
The canonical SMILES for 1,2-dichloroethane;propan-1-ol;propan-2-one is CC(C)=O.CCCO.ClCCCl.
What is the InChIKey of 1,2-dichloroethane;propan-1-ol;propan-2-one?
The InChIKey is KAJMOJUSDSHMMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H8O.C2H4Cl2/c1-3(2)4;1-2-3-4;3-1-2-4/h1-2H3;4H,2-3H2,1H3;1-2H2.
What are the key properties of 1,2-dichloroethane;propan-1-ol;propan-2-one?
1,2-dichloroethane;propan-1-ol;propan-2-one has a molecular weight of 217.14 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroethane;propan-1-ol;propan-2-one is sourced from PubChem (CID 88821608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).