About 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid
1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid (PubChem CID 88821671) has the molecular formula C25H20OS
and a molecular weight of 368.50 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid.
Molecular Properties
| Compound Name | 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid |
| PubChem CID | 88821671 |
| Molecular Formula | C25H20OS |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid |
| SMILES | O=C(S)c1ccc2c3c(cccc13)CC2.c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C13H10OS.C12H10/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-3,6-7H,4-5H2,(H,14,15);1-6H,7-8H2 |
| InChIKey | YCTJJVSIILZOLO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid?
The IUPAC name of 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid (CID 88821671) is 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid.
What is the SMILES notation for 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid?
The canonical SMILES for 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid is O=C(S)c1ccc2c3c(cccc13)CC2.c1cc2c3c(cccc3c1)CC2.
What is the InChIKey of 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid?
The InChIKey is YCTJJVSIILZOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS.C12H10/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-3,6-7H,4-5H2,(H,14,15);1-6H,7-8H2.
What are the key properties of 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid?
1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid has a molecular weight of 368.50 g/mol, XLogP of 5.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroacenaphthylene;1,2-dihydroacenaphthylene-5-carbothioic S-acid is sourced from PubChem (CID 88821671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).