About cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine
cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine (PubChem CID 88821684) has the molecular formula C23H36N4O3S2
and a molecular weight of 480.70 g/mol. Its IUPAC name is cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine.
Molecular Properties
| Compound Name | cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine |
| PubChem CID | 88821684 |
| Molecular Formula | C23H36N4O3S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine |
| SMILES | CCn1cc(SCC/N=C2/CCCN2C)c2ccccc21.NS(=O)(=O)OC1CCCCC1 |
| InChI | InChI=1S/C17H23N3S.C6H13NO3S/c1-3-20-13-16(14-7-4-5-8-15(14)20)21-12-10-18-17-9-6-11-19(17)2;7-11(8,9)10-6-4-2-1-3-5-6/h4-5,7-8,13H,3,6,9-12H2,1-2H3;6H,1-5H2,(H2,7,8,9)/b18-17-; |
| InChIKey | LTWLBHDUDSUDLK-YBFBCAGJSA-N |
| XLogP | 4.42 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine?
The IUPAC name of cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine (CID 88821684) is cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine.
What is the SMILES notation for cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine?
The canonical SMILES for cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine is CCn1cc(SCC/N=C2/CCCN2C)c2ccccc21.NS(=O)(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine?
The InChIKey is LTWLBHDUDSUDLK-YBFBCAGJSA-N. The full InChI is InChI=1S/C17H23N3S.C6H13NO3S/c1-3-20-13-16(14-7-4-5-8-15(14)20)21-12-10-18-17-9-6-11-19(17)2;7-11(8,9)10-6-4-2-1-3-5-6/h4-5,7-8,13H,3,6,9-12H2,1-2H3;6H,1-5H2,(H2,7,8,9)/b18-17-;.
What are the key properties of cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine?
cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine has a molecular weight of 480.70 g/mol, XLogP of 4.42, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl sulfamate;N-[2-(1-ethylindol-3-yl)sulfanylethyl]-1-methylpyrrolidin-2-imine is sourced from PubChem (CID 88821684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).