C39H57Br6Cl18O4P — CID 88821760
tris[1,3,3,5,5,7-hexachloro-4-(1,1-dibromoethyl)-2,2,6,6-tetramethylheptan-4-yl] phosphate (PubChem CID 88821760) has the molecular formula C39H57Br6Cl18O4P and a molecular weight of 1738.43 g/mol. Its IUPAC name is tris[1,3,3,5,5,7-hexachloro-4-(1,1-dibromoethyl)-2,2,6,6-tetramethylheptan-4-yl] phosphate.
| Compound Name | tris[1,3,3,5,5,7-hexachloro-4-(1,1-dibromoethyl)-2,2,6,6-tetramethylheptan-4-yl] phosphate |
|---|---|
| PubChem CID | 88821760 |
| Molecular Formula | C39H57Br6Cl18O4P |
| Molecular Weight | 1738.43 g/mol |
| Exact Mass | 1723.35 |
| IUPAC Name | tris[1,3,3,5,5,7-hexachloro-4-(1,1-dibromoethyl)-2,2,6,6-tetramethylheptan-4-yl] phosphate |
| SMILES | CC(Br)(Br)C(OP(=O)(OC(C(C)(Br)Br)(C(Cl)(Cl)C(C)(C)CCl)C(Cl)(Cl)C(C)(C)CCl)OC(C(C)(Br)Br)(C(Cl)(Cl)C(C)(C)CCl)C(Cl)(Cl)C(C)(C)CCl)(C(Cl)(Cl)C(C)(C)CCl)C(Cl)(Cl)C(C)(C)CCl |
| InChI | InChI=1S/C39H57Br6Cl18O4P/c1-22(2,16-46)34(52,53)31(28(13,40)41,35(54,55)23(3,4)17-47)65-68(64,66-32(29(14,42)43,36(56,57)24(5,6)18-48)37(58,59)25(7,8)19-49)67-33(30(15,44)45,38(60,61)26(9,10)20-50)39(62,63)27(11,12)21-51/h16-21H2,1-15H3 |
| InChIKey | BYUAQMPCZVLLCI-UHFFFAOYSA-N |
| XLogP | 23.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1738.43 |
| LogP ≤ 5 | 23.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|