About N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride
N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride (PubChem CID 88822051) has the molecular formula C11H11Cl2NS2
and a molecular weight of 292.26 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride.
Molecular Properties
| Compound Name | N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride |
| PubChem CID | 88822051 |
| Molecular Formula | C11H11Cl2NS2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride |
| SMILES | Cc1cs/c(=N\c2cc(Cl)ccc2C)s1.Cl |
| InChI | InChI=1S/C11H10ClNS2.ClH/c1-7-3-4-9(12)5-10(7)13-11-14-6-8(2)15-11;/h3-6H,1-2H3;1H/b13-11+; |
| InChIKey | TXFQAMVCQBEHAZ-BNSHTTSQSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride?
The IUPAC name of N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride (CID 88822051) is N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride.
What is the SMILES notation for N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride?
The canonical SMILES for N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride is Cc1cs/c(=N\c2cc(Cl)ccc2C)s1.Cl.
What is the InChIKey of N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride?
The InChIKey is TXFQAMVCQBEHAZ-BNSHTTSQSA-N. The full InChI is InChI=1S/C11H10ClNS2.ClH/c1-7-3-4-9(12)5-10(7)13-11-14-6-8(2)15-11;/h3-6H,1-2H3;1H/b13-11+;.
What are the key properties of N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride?
N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride has a molecular weight of 292.26 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-methylphenyl)-4-methyl-1,3-dithiol-2-imine;hydrochloride is sourced from PubChem (CID 88822051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).