About 1,1,2-trichloroethene;dihydrobromide
1,1,2-trichloroethene;dihydrobromide (PubChem CID 88822870) has the molecular formula C2H3Br2Cl3
and a molecular weight of 293.21 g/mol. Its IUPAC name is 1,1,2-trichloroethene;dihydrobromide.
Molecular Properties
| Compound Name | 1,1,2-trichloroethene;dihydrobromide |
| PubChem CID | 88822870 |
| Molecular Formula | C2H3Br2Cl3 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 289.77 |
| IUPAC Name | 1,1,2-trichloroethene;dihydrobromide |
| SMILES | Br.Br.ClC=C(Cl)Cl |
| InChI | InChI=1S/C2HCl3.2BrH/c3-1-2(4)5;;/h1H;2*1H |
| InChIKey | POITWSPLNAWMOA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trichloroethene;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trichloroethene;dihydrobromide?
The IUPAC name of 1,1,2-trichloroethene;dihydrobromide (CID 88822870) is 1,1,2-trichloroethene;dihydrobromide.
What is the SMILES notation for 1,1,2-trichloroethene;dihydrobromide?
The canonical SMILES for 1,1,2-trichloroethene;dihydrobromide is Br.Br.ClC=C(Cl)Cl.
What is the InChIKey of 1,1,2-trichloroethene;dihydrobromide?
The InChIKey is POITWSPLNAWMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HCl3.2BrH/c3-1-2(4)5;;/h1H;2*1H.
What are the key properties of 1,1,2-trichloroethene;dihydrobromide?
1,1,2-trichloroethene;dihydrobromide has a molecular weight of 293.21 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trichloroethene;dihydrobromide is sourced from PubChem (CID 88822870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).