About (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride
(3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride (PubChem CID 88823083) has the molecular formula C10H17ClN2O4S
and a molecular weight of 296.78 g/mol. Its IUPAC name is (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride.
Molecular Properties
| Compound Name | (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride |
| PubChem CID | 88823083 |
| Molecular Formula | C10H17ClN2O4S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride |
| SMILES | CC(=O)C(=O)ONC(=S)CCN1CCOCC1.Cl |
| InChI | InChI=1S/C10H16N2O4S.ClH/c1-8(13)10(14)16-11-9(17)2-3-12-4-6-15-7-5-12;/h2-7H2,1H3,(H,11,17);1H |
| InChIKey | XLZTYAKDGRWHHK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride?
The IUPAC name of (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride (CID 88823083) is (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride.
What is the SMILES notation for (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride?
The canonical SMILES for (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride is CC(=O)C(=O)ONC(=S)CCN1CCOCC1.Cl.
What is the InChIKey of (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride?
The InChIKey is XLZTYAKDGRWHHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4S.ClH/c1-8(13)10(14)16-11-9(17)2-3-12-4-6-15-7-5-12;/h2-7H2,1H3,(H,11,17);1H.
What are the key properties of (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride?
(3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride has a molecular weight of 296.78 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-morpholin-4-ylpropanethioylamino) 2-oxopropanoate;hydrochloride is sourced from PubChem (CID 88823083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).