C19H28O7 — CID 88823103
methyl (Z)-7-[(1S,2R,3S)-5-acetyloxy-3-(acetyloxymethyl)-2-formylcyclopentyl]hept-5-enoate (PubChem CID 88823103) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,2R,3S)-5-acetyloxy-3-(acetyloxymethyl)-2-formylcyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,2R,3S)-5-acetyloxy-3-(acetyloxymethyl)-2-formylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 88823103 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl (Z)-7-[(1S,2R,3S)-5-acetyloxy-3-(acetyloxymethyl)-2-formylcyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1C(OC(C)=O)C[C@H](COC(C)=O)[C@H]1C=O |
| InChI | InChI=1S/C19H28O7/c1-13(21)25-12-15-10-18(26-14(2)22)16(17(15)11-20)8-6-4-5-7-9-19(23)24-3/h4,6,11,15-18H,5,7-10,12H2,1-3H3/b6-4-/t15-,16+,17-,18?/m1/s1 |
| InChIKey | YBCNKLSNRUEWMH-PLQBQXADSA-N |
| XLogP | 2.22 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|