About [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate
[3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate (PubChem CID 88823146) has the molecular formula C23H27N3O4S
and a molecular weight of 441.55 g/mol. Its IUPAC name is [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate.
Molecular Properties
| Compound Name | [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate |
| PubChem CID | 88823146 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate |
| SMILES | C#CCCCN1CC(OC(=O)CCCC=C)N(c2nc3cc(OCC)ccc3s2)C1=O |
| InChI | InChI=1S/C23H27N3O4S/c1-4-7-9-11-21(27)30-20-16-25(14-10-8-5-2)23(28)26(20)22-24-18-15-17(29-6-3)12-13-19(18)31-22/h2,4,12-13,15,20H,1,6-11,14,16H2,3H3 |
| InChIKey | JQZPZJNUGMHPRV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate?
The IUPAC name of [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate (CID 88823146) is [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate.
What is the SMILES notation for [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate?
The canonical SMILES for [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate is C#CCCCN1CC(OC(=O)CCCC=C)N(c2nc3cc(OCC)ccc3s2)C1=O.
What is the InChIKey of [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate?
The InChIKey is JQZPZJNUGMHPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O4S/c1-4-7-9-11-21(27)30-20-16-25(14-10-8-5-2)23(28)26(20)22-24-18-15-17(29-6-3)12-13-19(18)31-22/h2,4,12-13,15,20H,1,6-11,14,16H2,3H3.
What are the key properties of [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate?
[3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate has a molecular weight of 441.55 g/mol, XLogP of 4.58, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-oxo-1-pent-4-ynylimidazolidin-4-yl] hex-5-enoate is sourced from PubChem (CID 88823146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).