About 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol
5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol (PubChem CID 88823648) has the molecular formula C13H20O8P2
and a molecular weight of 366.24 g/mol. Its IUPAC name is 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol.
Molecular Properties
| Compound Name | 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol |
| PubChem CID | 88823648 |
| Molecular Formula | C13H20O8P2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol |
| SMILES | COC1(P(=O)(OC)OC)CC(O)(c2ccccc2)P(=O)(OC)O1 |
| InChI | InChI=1S/C13H20O8P2/c1-17-13(23(16,19-3)20-4)10-12(14,22(15,18-2)21-13)11-8-6-5-7-9-11/h5-9,14H,10H2,1-4H3 |
| InChIKey | SUWLHYSQUOYOFZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol?
The IUPAC name of 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol (CID 88823648) is 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol.
What is the SMILES notation for 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol?
The canonical SMILES for 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol is COC1(P(=O)(OC)OC)CC(O)(c2ccccc2)P(=O)(OC)O1.
What is the InChIKey of 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol?
The InChIKey is SUWLHYSQUOYOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O8P2/c1-17-13(23(16,19-3)20-4)10-12(14,22(15,18-2)21-13)11-8-6-5-7-9-11/h5-9,14H,10H2,1-4H3.
What are the key properties of 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol?
5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol has a molecular weight of 366.24 g/mol, XLogP of 2.88, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-dimethoxyphosphoryl-2,5-dimethoxy-2-oxo-3-phenyl-1,2λ5-oxaphospholan-3-ol is sourced from PubChem (CID 88823648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).