C17H24O9S — CID 88823676
methyl (4S,5S)-5-[(1R,2S)-1,2-dihydroxy-3-(4-methylphenyl)sulfonyloxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 88823676) has the molecular formula C17H24O9S and a molecular weight of 404.44 g/mol. Its IUPAC name is methyl (4S,5S)-5-[(1R,2S)-1,2-dihydroxy-3-(4-methylphenyl)sulfonyloxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5S)-5-[(1R,2S)-1,2-dihydroxy-3-(4-methylphenyl)sulfonyloxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 88823676 |
| Molecular Formula | C17H24O9S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl (4S,5S)-5-[(1R,2S)-1,2-dihydroxy-3-(4-methylphenyl)sulfonyloxypropyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O9S/c1-10-5-7-11(8-6-10)27(21,22)24-9-12(18)13(19)14-15(16(20)23-4)26-17(2,3)25-14/h5-8,12-15,18-19H,9H2,1-4H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | RVNDPKBFBOWZKB-XGUBFFRZSA-N |
| XLogP | 0.12 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|