About acetonitrile;methyl 2-ethynylbut-3-ynoate
acetonitrile;methyl 2-ethynylbut-3-ynoate (PubChem CID 88823728) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is acetonitrile;methyl 2-ethynylbut-3-ynoate.
Molecular Properties
| Compound Name | acetonitrile;methyl 2-ethynylbut-3-ynoate |
| PubChem CID | 88823728 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | acetonitrile;methyl 2-ethynylbut-3-ynoate |
| SMILES | C#CC(C#C)C(=O)OC.CC#N |
| InChI | InChI=1S/C7H6O2.C2H3N/c1-4-6(5-2)7(8)9-3;1-2-3/h1-2,6H,3H3;1H3 |
| InChIKey | IEPHYBZIOJOBGT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;methyl 2-ethynylbut-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;methyl 2-ethynylbut-3-ynoate?
The IUPAC name of acetonitrile;methyl 2-ethynylbut-3-ynoate (CID 88823728) is acetonitrile;methyl 2-ethynylbut-3-ynoate.
What is the SMILES notation for acetonitrile;methyl 2-ethynylbut-3-ynoate?
The canonical SMILES for acetonitrile;methyl 2-ethynylbut-3-ynoate is C#CC(C#C)C(=O)OC.CC#N.
What is the InChIKey of acetonitrile;methyl 2-ethynylbut-3-ynoate?
The InChIKey is IEPHYBZIOJOBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H3N/c1-4-6(5-2)7(8)9-3;1-2-3/h1-2,6H,3H3;1H3.
What are the key properties of acetonitrile;methyl 2-ethynylbut-3-ynoate?
acetonitrile;methyl 2-ethynylbut-3-ynoate has a molecular weight of 163.18 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;methyl 2-ethynylbut-3-ynoate is sourced from PubChem (CID 88823728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).