About 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol
4-methyl-2,3-dihydro-1,4-thiazine-3-thiol (PubChem CID 88824834) has the molecular formula C5H9NS2
and a molecular weight of 147.27 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol |
| PubChem CID | 88824834 |
| Molecular Formula | C5H9NS2 |
| Molecular Weight | 147.27 g/mol |
| Exact Mass | 147.02 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol |
| SMILES | CN1C=CSCC1S |
| InChI | InChI=1S/C5H9NS2/c1-6-2-3-8-4-5(6)7/h2-3,5,7H,4H2,1H3 |
| InChIKey | YFRJCICHEPRZJK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol?
The IUPAC name of 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol (CID 88824834) is 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol.
What is the SMILES notation for 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol?
The canonical SMILES for 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol is CN1C=CSCC1S.
What is the InChIKey of 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol?
The InChIKey is YFRJCICHEPRZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NS2/c1-6-2-3-8-4-5(6)7/h2-3,5,7H,4H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol?
4-methyl-2,3-dihydro-1,4-thiazine-3-thiol has a molecular weight of 147.27 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1,4-thiazine-3-thiol is sourced from PubChem (CID 88824834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).