About N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride
N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride (PubChem CID 88825001) has the molecular formula C7H8Cl2N4O2
and a molecular weight of 251.07 g/mol. Its IUPAC name is N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride.
Molecular Properties
| Compound Name | N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride |
| PubChem CID | 88825001 |
| Molecular Formula | C7H8Cl2N4O2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride |
| SMILES | CCN(C(=O)Cl)c1nc(Cl)nc(OC)n1 |
| InChI | InChI=1S/C7H8Cl2N4O2/c1-3-13(5(9)14)6-10-4(8)11-7(12-6)15-2/h3H2,1-2H3 |
| InChIKey | ZEMLWNCZRVFNNJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride?
The IUPAC name of N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride (CID 88825001) is N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride.
What is the SMILES notation for N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride?
The canonical SMILES for N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride is CCN(C(=O)Cl)c1nc(Cl)nc(OC)n1.
What is the InChIKey of N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride?
The InChIKey is ZEMLWNCZRVFNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N4O2/c1-3-13(5(9)14)6-10-4(8)11-7(12-6)15-2/h3H2,1-2H3.
What are the key properties of N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride?
N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride has a molecular weight of 251.07 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-N-ethylcarbamoyl chloride is sourced from PubChem (CID 88825001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).